C19H25BrN2 — CID 175069379
N-[2-(6-bromo-2-pyridinyl)ethyl]-2,6-di(propan-2-yl)aniline (PubChem CID 175069379) has the molecular formula C19H25BrN2 and a molecular weight of 361.33 g/mol. Its IUPAC name is N-[2-(6-bromo-2-pyridinyl)ethyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[2-(6-bromo-2-pyridinyl)ethyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 175069379 |
| Molecular Formula | C19H25BrN2 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[2-(6-bromo-2-pyridinyl)ethyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1NCCc1cccc(Br)n1 |
| InChI | InChI=1S/C19H25BrN2/c1-13(2)16-8-6-9-17(14(3)4)19(16)21-12-11-15-7-5-10-18(20)22-15/h5-10,13-14,21H,11-12H2,1-4H3 |
| InChIKey | ZBWIHXZIICHUGJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|