C21H19NO — CID 136690856
2-[(2,6-dimethylphenyl)iminomethyl]-6-phenylphenol (PubChem CID 136690856) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenyl)iminomethyl]-6-phenylphenol.
| Compound Name | 2-[(2,6-dimethylphenyl)iminomethyl]-6-phenylphenol |
|---|---|
| PubChem CID | 136690856 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-[(2,6-dimethylphenyl)iminomethyl]-6-phenylphenol |
| SMILES | Cc1cccc(C)c1/N=C/c1cccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C21H19NO/c1-15-8-6-9-16(2)20(15)22-14-18-12-7-13-19(21(18)23)17-10-4-3-5-11-17/h3-14,23H,1-2H3/b22-14+ |
| InChIKey | OCXXDBOUQBIWGM-HYARGMPZSA-N |
| XLogP | 5.43 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|