C50H40N2O2 — CID 136654254
2-methyl-6-(naphthalen-2-yliminomethyl)phenol;2-methyl-6-[(2,4,6-triphenylphenyl)iminomethyl]phenol (PubChem CID 136654254) has the molecular formula C50H40N2O2 and a molecular weight of 700.88 g/mol. Its IUPAC name is 2-methyl-6-(naphthalen-2-yliminomethyl)phenol;2-methyl-6-[(2,4,6-triphenylphenyl)iminomethyl]phenol.
| Compound Name | 2-methyl-6-(naphthalen-2-yliminomethyl)phenol;2-methyl-6-[(2,4,6-triphenylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 136654254 |
| Molecular Formula | C50H40N2O2 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | 2-methyl-6-(naphthalen-2-yliminomethyl)phenol;2-methyl-6-[(2,4,6-triphenylphenyl)iminomethyl]phenol |
| SMILES | Cc1cccc(/C=N/c2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)c1O.Cc1cccc(/C=N/c2ccc3ccccc3c2)c1O |
| InChI | InChI=1S/C32H25NO.C18H15NO/c1-23-12-11-19-27(32(23)34)22-33-31-29(25-15-7-3-8-16-25)20-28(24-13-5-2-6-14-24)21-30(31)26-17-9-4-10-18-26;1-13-5-4-8-16(18(13)20)12-19-17-10-9-14-6-2-3-7-15(14)11-17/h2-22,34H,1H3;2-12,20H,1H3/b33-22+;19-12+ |
| InChIKey | GQPPSVBMCKNVTH-VYSMUPBOSA-N |
| XLogP | 13.06 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|