C36H40N4 — CID 102289845
N-[2-[[(1R,2R)-2-[[2-(2,6-dimethylanilino)phenyl]methylideneamino]cyclohexyl]iminomethyl]phenyl]-2,6-dimethylaniline (PubChem CID 102289845) has the molecular formula C36H40N4 and a molecular weight of 528.74 g/mol. Its IUPAC name is N-[2-[[(1R,2R)-2-[[2-(2,6-dimethylanilino)phenyl]methylideneamino]cyclohexyl]iminomethyl]phenyl]-2,6-dimethylaniline.
| Compound Name | N-[2-[[(1R,2R)-2-[[2-(2,6-dimethylanilino)phenyl]methylideneamino]cyclohexyl]iminomethyl]phenyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 102289845 |
| Molecular Formula | C36H40N4 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | N-[2-[[(1R,2R)-2-[[2-(2,6-dimethylanilino)phenyl]methylideneamino]cyclohexyl]iminomethyl]phenyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1Nc1ccccc1/C=N\[C@@H]1CCCC[C@H]1/N=C/c1ccccc1Nc1c(C)cccc1C |
| InChI | InChI=1S/C36H40N4/c1-25-13-11-14-26(2)35(25)39-31-19-7-5-17-29(31)23-37-33-21-9-10-22-34(33)38-24-30-18-6-8-20-32(30)40-36-27(3)15-12-16-28(36)4/h5-8,11-20,23-24,33-34,39-40H,9-10,21-22H2,1-4H3/b37-23-,38-24+/t33-,34-/m1/s1 |
| InChIKey | STIAKESAVRQKFO-PVSLUKDNSA-N |
| XLogP | 9.26 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|