C33H33Cl2CoN2P — CID 158379041
dichlorocobalt;N-[2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]-1-(2-methylphenyl)methanimine (PubChem CID 158379041) has the molecular formula C33H33Cl2CoN2P and a molecular weight of 618.45 g/mol. Its IUPAC name is dichlorocobalt;N-[2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]-1-(2-methylphenyl)methanimine.
| Compound Name | dichlorocobalt;N-[2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]-1-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 158379041 |
| Molecular Formula | C33H33Cl2CoN2P |
| Molecular Weight | 618.45 g/mol |
| Exact Mass | 617.11 |
| IUPAC Name | dichlorocobalt;N-[2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]-1-(2-methylphenyl)methanimine |
| SMILES | Cc1ccccc1/C=N/C1CCCCC1/N=C\c1ccccc1P(c1ccccc1)c1ccccc1.Cl[Co]Cl |
| InChI | InChI=1S/C33H33N2P.2ClH.Co/c1-26-14-8-9-15-27(26)24-34-31-21-11-12-22-32(31)35-25-28-16-10-13-23-33(28)36(29-17-4-2-5-18-29)30-19-6-3-7-20-30;;;/h2-10,13-20,23-25,31-32H,11-12,21-22H2,1H3;2*1H;/q;;;+2/p-2/b34-24+,35-25-;;; |
| InChIKey | GVOFEPUJBGZRHE-JLSWKRROSA-L |
| XLogP | 7.98 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.45 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|