C44H40Cl2N2P2Ru — CID 11721979
dichlororuthenium;1-(2-diphenylphosphanylphenyl)-N-[(1S,2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]methanimine (PubChem CID 11721979) has the molecular formula C44H40Cl2N2P2Ru and a molecular weight of 830.74 g/mol. Its IUPAC name is dichlororuthenium;1-(2-diphenylphosphanylphenyl)-N-[(1S,2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]methanimine.
| Compound Name | dichlororuthenium;1-(2-diphenylphosphanylphenyl)-N-[(1S,2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]methanimine |
|---|---|
| PubChem CID | 11721979 |
| Molecular Formula | C44H40Cl2N2P2Ru |
| Molecular Weight | 830.74 g/mol |
| Exact Mass | 830.11 |
| IUPAC Name | dichlororuthenium;1-(2-diphenylphosphanylphenyl)-N-[(1S,2S)-2-[(2-diphenylphosphanylphenyl)methylideneamino]cyclohexyl]methanimine |
| SMILES | C(=N\[C@H]1CCCC[C@@H]1/N=C\c1ccccc1P(c1ccccc1)c1ccccc1)\c1ccccc1P(c1ccccc1)c1ccccc1.Cl[Ru]Cl |
| InChI | InChI=1S/C44H40N2P2.2ClH.Ru/c1-5-21-37(22-6-1)47(38-23-7-2-8-24-38)43-31-17-13-19-35(43)33-45-41-29-15-16-30-42(41)46-34-36-20-14-18-32-44(36)48(39-25-9-3-10-26-39)40-27-11-4-12-28-40;;;/h1-14,17-28,31-34,41-42H,15-16,29-30H2;2*1H;/q;;;+2/p-2/b45-33-,46-34-;;;/t41-,42-;;;/m0.../s1 |
| InChIKey | POFAOWHLEWYWPG-FANGNJPDSA-L |
| XLogP | 9.43 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.74 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|