C32H28N2Na2O2 — CID 102085812
disodium;2-[[(1R,2R)-2-[(2-oxido-3-phenylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-phenylphenolate (PubChem CID 102085812) has the molecular formula C32H28N2Na2O2 and a molecular weight of 518.57 g/mol. Its IUPAC name is disodium;2-[[(1R,2R)-2-[(2-oxido-3-phenylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-phenylphenolate.
| Compound Name | disodium;2-[[(1R,2R)-2-[(2-oxido-3-phenylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-phenylphenolate |
|---|---|
| PubChem CID | 102085812 |
| Molecular Formula | C32H28N2Na2O2 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | disodium;2-[[(1R,2R)-2-[(2-oxido-3-phenylphenyl)methylideneamino]cyclohexyl]iminomethyl]-6-phenylphenolate |
| SMILES | [Na+].[Na+].[O-]c1c(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cccc(-c3ccccc3)c2[O-])cccc1-c1ccccc1 |
| InChI | InChI=1S/C32H30N2O2.2Na/c35-31-25(15-9-17-27(31)23-11-3-1-4-12-23)21-33-29-19-7-8-20-30(29)34-22-26-16-10-18-28(32(26)36)24-13-5-2-6-14-24;;/h1-6,9-18,21-22,29-30,35-36H,7-8,19-20H2;;/q;2*+1/p-2/b33-21+,34-22+;;/t29-,30-;;/m1../s1 |
| InChIKey | QMNJZXFZLOOKED-JQRPVDSNSA-L |
| XLogP | 0.03 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|