C20H24N2P2 — CID 135032202
1-(2-phosphanylphenyl)-N-[(1S,2S)-2-[(2-phosphanylphenyl)methylideneamino]cyclohexyl]methanimine (PubChem CID 135032202) has the molecular formula C20H24N2P2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-(2-phosphanylphenyl)-N-[(1S,2S)-2-[(2-phosphanylphenyl)methylideneamino]cyclohexyl]methanimine.
| Compound Name | 1-(2-phosphanylphenyl)-N-[(1S,2S)-2-[(2-phosphanylphenyl)methylideneamino]cyclohexyl]methanimine |
|---|---|
| PubChem CID | 135032202 |
| Molecular Formula | C20H24N2P2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-(2-phosphanylphenyl)-N-[(1S,2S)-2-[(2-phosphanylphenyl)methylideneamino]cyclohexyl]methanimine |
| SMILES | Pc1ccccc1/C=N\[C@H]1CCCC[C@@H]1/N=C/c1ccccc1P |
| InChI | InChI=1S/C20H24N2P2/c23-19-11-5-1-7-15(19)13-21-17-9-3-4-10-18(17)22-14-16-8-2-6-12-20(16)24/h1-2,5-8,11-14,17-18H,3-4,9-10,23-24H2/b21-13-,22-14+/t17-,18-/m0/s1 |
| InChIKey | FORWMDYKZJTHST-YEXJTHAESA-N |
| XLogP | 3.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|