C60H60F6N6O6 — CID 139203860
2-fluoro-6-[[(1R,2R)-2-[(3-fluoro-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol (PubChem CID 139203860) has the molecular formula C60H60F6N6O6 and a molecular weight of 1075.16 g/mol. Its IUPAC name is 2-fluoro-6-[[(1R,2R)-2-[(3-fluoro-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol.
| Compound Name | 2-fluoro-6-[[(1R,2R)-2-[(3-fluoro-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 139203860 |
| Molecular Formula | C60H60F6N6O6 |
| Molecular Weight | 1075.16 g/mol |
| Exact Mass | 1074.45 |
| IUPAC Name | 2-fluoro-6-[[(1R,2R)-2-[(3-fluoro-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol |
| SMILES | Oc1c(F)cccc1/C=N/[C@@H]1CCCC[C@H]1/N=C/c1cccc(F)c1O.Oc1c(F)cccc1/C=N/[C@@H]1CCCC[C@H]1/N=C/c1cccc(F)c1O.Oc1c(F)cccc1/C=N/[C@@H]1CCCC[C@H]1/N=C/c1cccc(F)c1O |
| InChI | InChI=1S/3C20H20F2N2O2/c3*21-15-7-3-5-13(19(15)25)11-23-17-9-1-2-10-18(17)24-12-14-6-4-8-16(22)20(14)26/h3*3-8,11-12,17-18,25-26H,1-2,9-10H2/b3*23-11+,24-12+/t3*17-,18-/m111/s1 |
| InChIKey | LCPLYUBMRPSPLG-NJNVZQSTSA-N |
| XLogP | 12.68 |
| TPSA | 195.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.16 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|