C20H18Cl4N2O2 — CID 2265555
2,4-dichloro-6-[[(1R,2S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol (PubChem CID 2265555) has the molecular formula C20H18Cl4N2O2 and a molecular weight of 460.19 g/mol. Its IUPAC name is 2,4-dichloro-6-[[(1R,2S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[[(1R,2S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 2265555 |
| Molecular Formula | C20H18Cl4N2O2 |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 2,4-dichloro-6-[[(1R,2S)-2-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclohexyl]iminomethyl]phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/[C@H]1CCCC[C@H]1/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C20H18Cl4N2O2/c21-13-5-11(19(27)15(23)7-13)9-25-17-3-1-2-4-18(17)26-10-12-6-14(22)8-16(24)20(12)28/h5-10,17-18,27-28H,1-4H2/b25-9+,26-10+/t17-,18+ |
| InChIKey | HRSBPQZCDSPHDC-INADVXLTSA-N |
| XLogP | 6.56 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|