C20H20Cl2N2O — CID 135975962
5-chloro-2-[[(1S)-2-[(4-chlorophenyl)methylideneamino]cyclohexyl]iminomethyl]phenol (PubChem CID 135975962) has the molecular formula C20H20Cl2N2O and a molecular weight of 375.30 g/mol. Its IUPAC name is 5-chloro-2-[[(1S)-2-[(4-chlorophenyl)methylideneamino]cyclohexyl]iminomethyl]phenol.
| Compound Name | 5-chloro-2-[[(1S)-2-[(4-chlorophenyl)methylideneamino]cyclohexyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135975962 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 5-chloro-2-[[(1S)-2-[(4-chlorophenyl)methylideneamino]cyclohexyl]iminomethyl]phenol |
| SMILES | Oc1cc(Cl)ccc1/C=N/[C@H]1CCCCC1/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O/c21-16-8-5-14(6-9-16)12-23-18-3-1-2-4-19(18)24-13-15-7-10-17(22)11-20(15)25/h5-13,18-19,25H,1-4H2/b23-12+,24-13+/t18?,19-/m0/s1 |
| InChIKey | IOFRLKZNYADEAU-BTQRBWJUSA-N |
| XLogP | 5.55 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|