C21H24N2O3 — CID 157078138
4-[[2-[(2-hydroxy-4-methylphenyl)methylideneamino]cyclohexyl]iminomethyl]benzene-1,3-diol (PubChem CID 157078138) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[[2-[(2-hydroxy-4-methylphenyl)methylideneamino]cyclohexyl]iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[[2-[(2-hydroxy-4-methylphenyl)methylideneamino]cyclohexyl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 157078138 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-[[2-[(2-hydroxy-4-methylphenyl)methylideneamino]cyclohexyl]iminomethyl]benzene-1,3-diol |
| SMILES | Cc1ccc(/C=N/C2CCCCC2/N=C/c2ccc(O)cc2O)c(O)c1 |
| InChI | InChI=1S/C21H24N2O3/c1-14-6-7-15(20(25)10-14)12-22-18-4-2-3-5-19(18)23-13-16-8-9-17(24)11-21(16)26/h6-13,18-19,24-26H,2-5H2,1H3/b22-12+,23-13+ |
| InChIKey | AUDDGOXKOJFJFQ-FWSOMWAYSA-N |
| XLogP | 3.96 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|