About 2-(hydroxyiminomethyl)-5-methylphenol;iron
2-(hydroxyiminomethyl)-5-methylphenol;iron (PubChem CID 175124373) has the molecular formula C8H9FeNO2
and a molecular weight of 207.01 g/mol. Its IUPAC name is 2-(hydroxyiminomethyl)-5-methylphenol;iron.
Molecular Properties
| Compound Name | 2-(hydroxyiminomethyl)-5-methylphenol;iron |
| PubChem CID | 175124373 |
| Molecular Formula | C8H9FeNO2 |
| Molecular Weight | 207.01 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | 2-(hydroxyiminomethyl)-5-methylphenol;iron |
| SMILES | Cc1ccc(C=NO)c(O)c1.[Fe] |
| InChI | InChI=1S/C8H9NO2.Fe/c1-6-2-3-7(5-9-11)8(10)4-6;/h2-5,10-11H,1H3; |
| InChIKey | JPBTYSCBPVERNF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.01 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxyiminomethyl)-5-methylphenol;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxyiminomethyl)-5-methylphenol;iron?
The IUPAC name of 2-(hydroxyiminomethyl)-5-methylphenol;iron (CID 175124373) is 2-(hydroxyiminomethyl)-5-methylphenol;iron.
What is the SMILES notation for 2-(hydroxyiminomethyl)-5-methylphenol;iron?
The canonical SMILES for 2-(hydroxyiminomethyl)-5-methylphenol;iron is Cc1ccc(C=NO)c(O)c1.[Fe].
What is the InChIKey of 2-(hydroxyiminomethyl)-5-methylphenol;iron?
The InChIKey is JPBTYSCBPVERNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.Fe/c1-6-2-3-7(5-9-11)8(10)4-6;/h2-5,10-11H,1H3;.
What are the key properties of 2-(hydroxyiminomethyl)-5-methylphenol;iron?
2-(hydroxyiminomethyl)-5-methylphenol;iron has a molecular weight of 207.01 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxyiminomethyl)-5-methylphenol;iron is sourced from PubChem (CID 175124373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).