About cobalt;bis(2-(hydroxyiminomethyl)phenol)
cobalt;bis(2-(hydroxyiminomethyl)phenol) (PubChem CID 158420458) has the molecular formula C14H14CoN2O4
and a molecular weight of 333.21 g/mol. Its IUPAC name is cobalt;bis(2-(hydroxyiminomethyl)phenol).
Molecular Properties
| Compound Name | cobalt;bis(2-(hydroxyiminomethyl)phenol) |
| PubChem CID | 158420458 |
| Molecular Formula | C14H14CoN2O4 |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | cobalt;bis(2-(hydroxyiminomethyl)phenol) |
| SMILES | ON=Cc1ccccc1O.ON=Cc1ccccc1O.[Co] |
| InChI | InChI=1S/2C7H7NO2.Co/c2*9-7-4-2-1-3-6(7)5-8-10;/h2*1-5,9-10H; |
| InChIKey | HAKTXJONQXCQFF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cobalt;bis(2-(hydroxyiminomethyl)phenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(2-(hydroxyiminomethyl)phenol)?
The IUPAC name of cobalt;bis(2-(hydroxyiminomethyl)phenol) (CID 158420458) is cobalt;bis(2-(hydroxyiminomethyl)phenol).
What is the SMILES notation for cobalt;bis(2-(hydroxyiminomethyl)phenol)?
The canonical SMILES for cobalt;bis(2-(hydroxyiminomethyl)phenol) is ON=Cc1ccccc1O.ON=Cc1ccccc1O.[Co].
What is the InChIKey of cobalt;bis(2-(hydroxyiminomethyl)phenol)?
The InChIKey is HAKTXJONQXCQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7NO2.Co/c2*9-7-4-2-1-3-6(7)5-8-10;/h2*1-5,9-10H;.
What are the key properties of cobalt;bis(2-(hydroxyiminomethyl)phenol)?
cobalt;bis(2-(hydroxyiminomethyl)phenol) has a molecular weight of 333.21 g/mol, XLogP of 2.40, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(2-(hydroxyiminomethyl)phenol) is sourced from PubChem (CID 158420458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).