About copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate
copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate (PubChem CID 137286073) has the molecular formula C7H10CuN2O2
and a molecular weight of 217.72 g/mol. Its IUPAC name is copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate.
Molecular Properties
| Compound Name | copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate |
| PubChem CID | 137286073 |
| Molecular Formula | C7H10CuN2O2 |
| Molecular Weight | 217.72 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate |
| SMILES | N/N=C/c1ccccc1O.O.[Cu] |
| InChI | InChI=1S/C7H8N2O.Cu.H2O/c8-9-5-6-3-1-2-4-7(6)10;;/h1-5,10H,8H2;;1H2/b9-5+;; |
| InChIKey | SOQALOIGVPZGPA-KJDUPKRESA-N |
| XLogP | -0.14 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.72 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate?
The IUPAC name of copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate (CID 137286073) is copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate.
What is the SMILES notation for copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate?
The canonical SMILES for copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate is N/N=C/c1ccccc1O.O.[Cu].
What is the InChIKey of copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate?
The InChIKey is SOQALOIGVPZGPA-KJDUPKRESA-N. The full InChI is InChI=1S/C7H8N2O.Cu.H2O/c8-9-5-6-3-1-2-4-7(6)10;;/h1-5,10H,8H2;;1H2/b9-5+;;.
What are the key properties of copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate?
copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate has a molecular weight of 217.72 g/mol, XLogP of -0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-[(E)-hydrazinylidenemethyl]phenol;hydrate is sourced from PubChem (CID 137286073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).