C24H30N6O3 — CID 172938978
2-[(E)-(dimethylhydrazinylidene)methyl]phenol;2-[(E)-hydrazinylidenemethyl]phenol;2-[(E)-(methylhydrazinylidene)methyl]phenol (PubChem CID 172938978) has the molecular formula C24H30N6O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is 2-[(E)-(dimethylhydrazinylidene)methyl]phenol;2-[(E)-hydrazinylidenemethyl]phenol;2-[(E)-(methylhydrazinylidene)methyl]phenol.
| Compound Name | 2-[(E)-(dimethylhydrazinylidene)methyl]phenol;2-[(E)-hydrazinylidenemethyl]phenol;2-[(E)-(methylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 172938978 |
| Molecular Formula | C24H30N6O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 2-[(E)-(dimethylhydrazinylidene)methyl]phenol;2-[(E)-hydrazinylidenemethyl]phenol;2-[(E)-(methylhydrazinylidene)methyl]phenol |
| SMILES | CN(C)/N=C/c1ccccc1O.CN/N=C/c1ccccc1O.N/N=C/c1ccccc1O |
| InChI | InChI=1S/C9H12N2O.C8H10N2O.C7H8N2O/c1-11(2)10-7-8-5-3-4-6-9(8)12;1-9-10-6-7-4-2-3-5-8(7)11;8-9-5-6-3-1-2-4-7(6)10/h3-7,12H,1-2H3;2-6,9,11H,1H3;1-5,10H,8H2/b10-7+;10-6+;9-5+ |
| InChIKey | UVWUUOXSYZYQEK-ONYLAPORSA-N |
| XLogP | 2.92 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|