About ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+)
ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+) (PubChem CID 135860591) has the molecular formula C12H20N2O2Sn+4
and a molecular weight of 343.02 g/mol. Its IUPAC name is ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+).
Molecular Properties
| Compound Name | ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+) |
| PubChem CID | 135860591 |
| Molecular Formula | C12H20N2O2Sn+4 |
| Molecular Weight | 343.02 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+) |
| SMILES | CC.CC.O=CN/N=C/c1ccccc1O.[Sn+4] |
| InChI | InChI=1S/C8H8N2O2.2C2H6.Sn/c11-6-10-9-5-7-3-1-2-4-8(7)12;2*1-2;/h1-6,12H,(H,10,11);2*1-2H3;/q;;;+4/b9-5+;;; |
| InChIKey | KGCHJZAJHGKHKP-GONNCMOWSA-N |
| XLogP | 2.14 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.02 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+)?
The IUPAC name of ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+) (CID 135860591) is ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+).
What is the SMILES notation for ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+)?
The canonical SMILES for ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+) is CC.CC.O=CN/N=C/c1ccccc1O.[Sn+4].
What is the InChIKey of ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+)?
The InChIKey is KGCHJZAJHGKHKP-GONNCMOWSA-N. The full InChI is InChI=1S/C8H8N2O2.2C2H6.Sn/c11-6-10-9-5-7-3-1-2-4-8(7)12;2*1-2;/h1-6,12H,(H,10,11);2*1-2H3;/q;;;+4/b9-5+;;;.
What are the key properties of ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+)?
ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+) has a molecular weight of 343.02 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(E)-(2-hydroxyphenyl)methylideneamino]formamide;tin(4+) is sourced from PubChem (CID 135860591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).