C15H14N4O2S — CID 3446799
1,3-bis[(2-hydroxyphenyl)methylideneamino]thiourea (PubChem CID 3446799) has the molecular formula C15H14N4O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 1,3-bis[(2-hydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1,3-bis[(2-hydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 3446799 |
| Molecular Formula | C15H14N4O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1,3-bis[(2-hydroxyphenyl)methylideneamino]thiourea |
| SMILES | Oc1ccccc1C=NNC(=S)NN=Cc1ccccc1O |
| InChI | InChI=1S/C15H14N4O2S/c20-13-7-3-1-5-11(13)9-16-18-15(22)19-17-10-12-6-2-4-8-14(12)21/h1-10,20-21H,(H2,18,19,22) |
| InChIKey | IPCADHRTCDSGLW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|