C20H24N8O2S2 — CID 135527146
1-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-[4-[[(Z)-(2-hydroxyphenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea (PubChem CID 135527146) has the molecular formula C20H24N8O2S2 and a molecular weight of 472.60 g/mol. Its IUPAC name is 1-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-[4-[[(Z)-(2-hydroxyphenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea.
| Compound Name | 1-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-[4-[[(Z)-(2-hydroxyphenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea |
|---|---|
| PubChem CID | 135527146 |
| Molecular Formula | C20H24N8O2S2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-[(Z)-(2-hydroxyphenyl)methylideneamino]-3-[4-[[(Z)-(2-hydroxyphenyl)methylideneamino]carbamothioylamino]piperazin-1-yl]thiourea |
| SMILES | Oc1ccccc1/C=N\NC(=S)NN1CCN(NC(=S)N/N=C\c2ccccc2O)CC1 |
| InChI | InChI=1S/C20H24N8O2S2/c29-17-7-3-1-5-15(17)13-21-23-19(31)25-27-9-11-28(12-10-27)26-20(32)24-22-14-16-6-2-4-8-18(16)30/h1-8,13-14,29-30H,9-12H2,(H2,23,25,31)(H2,24,26,32)/b21-13-,22-14- |
| InChIKey | GQDKWLJNCQALOS-JZTLMNBPSA-N |
| XLogP | 0.84 |
| TPSA | 119.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|