C8H7Cl2N3OS — CID 137178247
1,1-dichloro-3-[(2-hydroxyphenyl)methylideneamino]thiourea (PubChem CID 137178247) has the molecular formula C8H7Cl2N3OS and a molecular weight of 264.14 g/mol. Its IUPAC name is 1,1-dichloro-3-[(2-hydroxyphenyl)methylideneamino]thiourea.
| Compound Name | 1,1-dichloro-3-[(2-hydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 137178247 |
| Molecular Formula | C8H7Cl2N3OS |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 1,1-dichloro-3-[(2-hydroxyphenyl)methylideneamino]thiourea |
| SMILES | Oc1ccccc1C=NNC(=S)N(Cl)Cl |
| InChI | InChI=1S/C8H7Cl2N3OS/c9-13(10)8(15)12-11-5-6-3-1-2-4-7(6)14/h1-5,14H,(H,12,15) |
| InChIKey | IWPBJRDIQRGULD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|