C17H12N6S — CID 131998213
1,3-bis[(E)-(2-cyanophenyl)methylideneamino]thiourea (PubChem CID 131998213) has the molecular formula C17H12N6S and a molecular weight of 332.39 g/mol. Its IUPAC name is 1,3-bis[(E)-(2-cyanophenyl)methylideneamino]thiourea.
| Compound Name | 1,3-bis[(E)-(2-cyanophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 131998213 |
| Molecular Formula | C17H12N6S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1,3-bis[(E)-(2-cyanophenyl)methylideneamino]thiourea |
| SMILES | N#Cc1ccccc1/C=N/NC(=S)N/N=C/c1ccccc1C#N |
| InChI | InChI=1S/C17H12N6S/c18-9-13-5-1-3-7-15(13)11-20-22-17(24)23-21-12-16-8-4-2-6-14(16)10-19/h1-8,11-12H,(H2,22,23,24)/b20-11+,21-12+ |
| InChIKey | LYLVPTIIVQMSJN-HGEIODPWSA-N |
| XLogP | 2.26 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|