C21H26N4O2S — CID 2566373
1,3-bis[(2-propan-2-yloxyphenyl)methylideneamino]thiourea (PubChem CID 2566373) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 1,3-bis[(2-propan-2-yloxyphenyl)methylideneamino]thiourea.
| Compound Name | 1,3-bis[(2-propan-2-yloxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 2566373 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1,3-bis[(2-propan-2-yloxyphenyl)methylideneamino]thiourea |
| SMILES | CC(C)Oc1ccccc1C=NNC(=S)NN=Cc1ccccc1OC(C)C |
| InChI | InChI=1S/C21H26N4O2S/c1-15(2)26-19-11-7-5-9-17(19)13-22-24-21(28)25-23-14-18-10-6-8-12-20(18)27-16(3)4/h5-16H,1-4H3,(H2,24,25,28) |
| InChIKey | FIQPZVHVADHEFG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|