C18H22N2O — CID 110841094
3,4-dimethyl-N-[(2-propan-2-yloxyphenyl)methylideneamino]aniline (PubChem CID 110841094) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(2-propan-2-yloxyphenyl)methylideneamino]aniline.
| Compound Name | 3,4-dimethyl-N-[(2-propan-2-yloxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 110841094 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3,4-dimethyl-N-[(2-propan-2-yloxyphenyl)methylideneamino]aniline |
| SMILES | Cc1ccc(NN=Cc2ccccc2OC(C)C)cc1C |
| InChI | InChI=1S/C18H22N2O/c1-13(2)21-18-8-6-5-7-16(18)12-19-20-17-10-9-14(3)15(4)11-17/h5-13,20H,1-4H3 |
| InChIKey | GHUHZJSDQDMQAK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|