C16H15F3N2 — CID 110504935
3,4-dimethyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]aniline (PubChem CID 110504935) has the molecular formula C16H15F3N2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]aniline.
| Compound Name | 3,4-dimethyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 110504935 |
| Molecular Formula | C16H15F3N2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3,4-dimethyl-N-[(E)-[2-(trifluoromethyl)phenyl]methylideneamino]aniline |
| SMILES | Cc1ccc(N/N=C/c2ccccc2C(F)(F)F)cc1C |
| InChI | InChI=1S/C16H15F3N2/c1-11-7-8-14(9-12(11)2)21-20-10-13-5-3-4-6-15(13)16(17,18)19/h3-10,21H,1-2H3/b20-10+ |
| InChIKey | SZSOFHOIUITIMT-KEBDBYFISA-N |
| XLogP | 4.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|