C20H18F3N3S — CID 110533144
N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine (PubChem CID 110533144) has the molecular formula C20H18F3N3S and a molecular weight of 389.45 g/mol. Its IUPAC name is N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110533144 |
| Molecular Formula | C20H18F3N3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(C)c(-c2csc(N/N=C\c3ccccc3C(F)(F)F)n2)c(C)c1 |
| InChI | InChI=1S/C20H18F3N3S/c1-12-8-13(2)18(14(3)9-12)17-11-27-19(25-17)26-24-10-15-6-4-5-7-16(15)20(21,22)23/h4-11H,1-3H3,(H,25,26)/b24-10- |
| InChIKey | LGPZCFDRCXKDHH-VROXFSQNSA-N |
| XLogP | 6.20 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|