C17H10BrF4N3S — CID 168578213
N-[[6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168578213) has the molecular formula C17H10BrF4N3S and a molecular weight of 444.25 g/mol. Its IUPAC name is N-[[6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168578213 |
| Molecular Formula | C17H10BrF4N3S |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | N-[[6-bromo-2-fluoro-3-(trifluoromethyl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Fc1c(C(F)(F)F)ccc(Br)c1C=NNc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H10BrF4N3S/c18-13-7-6-12(17(20,21)22)15(19)11(13)8-23-25-16-24-14(9-26-16)10-4-2-1-3-5-10/h1-9H,(H,24,25) |
| InChIKey | AVGXAJQWYBXLCI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|