C16H10BrF2N3S — CID 168578789
N-[(3-bromo-2,4-difluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168578789) has the molecular formula C16H10BrF2N3S and a molecular weight of 394.24 g/mol. Its IUPAC name is N-[(3-bromo-2,4-difluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(3-bromo-2,4-difluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168578789 |
| Molecular Formula | C16H10BrF2N3S |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | N-[(3-bromo-2,4-difluorophenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(C=NNc2nc(-c3ccccc3)cs2)c(F)c1Br |
| InChI | InChI=1S/C16H10BrF2N3S/c17-14-12(18)7-6-11(15(14)19)8-20-22-16-21-13(9-23-16)10-4-2-1-3-5-10/h1-9H,(H,21,22) |
| InChIKey | JNDNMNFSDURVMN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|