C14H7F7N2 — CID 6291151
2,3,5,6-tetrafluoro-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]aniline (PubChem CID 6291151) has the molecular formula C14H7F7N2 and a molecular weight of 336.21 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 6291151 |
| Molecular Formula | C14H7F7N2 |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]aniline |
| SMILES | Fc1cc(F)c(F)c(N/N=C\c2ccccc2C(F)(F)F)c1F |
| InChI | InChI=1S/C14H7F7N2/c15-9-5-10(16)12(18)13(11(9)17)23-22-6-7-3-1-2-4-8(7)14(19,20)21/h1-6,23H/b22-6- |
| InChIKey | NNKYPDQPGIIXEM-HCDFXORVSA-N |
| XLogP | 4.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|