C16H14F4N2O3 — CID 3458864
2,3,5,6-tetrafluoro-N-[(2,4,5-trimethoxyphenyl)methylideneamino]aniline (PubChem CID 3458864) has the molecular formula C16H14F4N2O3 and a molecular weight of 358.29 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(2,4,5-trimethoxyphenyl)methylideneamino]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(2,4,5-trimethoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 3458864 |
| Molecular Formula | C16H14F4N2O3 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(2,4,5-trimethoxyphenyl)methylideneamino]aniline |
| SMILES | COc1cc(OC)c(OC)cc1C=NNc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C16H14F4N2O3/c1-23-11-6-13(25-3)12(24-2)4-8(11)7-21-22-16-14(19)9(17)5-10(18)15(16)20/h4-7,22H,1-3H3 |
| InChIKey | JBRQMCOLOMBONS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|