C15H10F4N2O2 — CID 3659610
methyl 4-[[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]benzoate (PubChem CID 3659610) has the molecular formula C15H10F4N2O2 and a molecular weight of 326.25 g/mol. Its IUPAC name is methyl 4-[[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 3659610 |
| Molecular Formula | C15H10F4N2O2 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | methyl 4-[[(2,3,5,6-tetrafluorophenyl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C15H10F4N2O2/c1-23-15(22)9-4-2-8(3-5-9)7-20-21-14-12(18)10(16)6-11(17)13(14)19/h2-7,21H,1H3 |
| InChIKey | LERUPMHZHUMLAM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|