C13H7F4N3O2 — CID 3888449
2,3,5,6-tetrafluoro-N-[(4-nitrophenyl)methylideneamino]aniline (PubChem CID 3888449) has the molecular formula C13H7F4N3O2 and a molecular weight of 313.21 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[(4-nitrophenyl)methylideneamino]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[(4-nitrophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 3888449 |
| Molecular Formula | C13H7F4N3O2 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[(4-nitrophenyl)methylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(C=NNc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C13H7F4N3O2/c14-9-5-10(15)12(17)13(11(9)16)19-18-6-7-1-3-8(4-2-7)20(21)22/h1-6,19H |
| InChIKey | HKJFBJBZDGKLLF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|