C17H9F4N3O3 — CID 4297577
2,3,5,6-tetrafluoro-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]aniline (PubChem CID 4297577) has the molecular formula C17H9F4N3O3 and a molecular weight of 379.27 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]aniline |
|---|---|
| PubChem CID | 4297577 |
| Molecular Formula | C17H9F4N3O3 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]aniline |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(C=NNc3c(F)c(F)cc(F)c3F)o2)cc1 |
| InChI | InChI=1S/C17H9F4N3O3/c18-12-7-13(19)16(21)17(15(12)20)23-22-8-11-5-6-14(27-11)9-1-3-10(4-2-9)24(25)26/h1-8,23H |
| InChIKey | XJDPJEVJMDISIZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|