C17H18N4O3 — CID 2313614
N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 2313614) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 2313614 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(C=NNC3=NCCCCC3)o2)cc1 |
| InChI | InChI=1S/C17H18N4O3/c22-21(23)14-7-5-13(6-8-14)16-10-9-15(24-16)12-19-20-17-4-2-1-3-11-18-17/h5-10,12H,1-4,11H2,(H,18,20) |
| InChIKey | VTYGIJZLWWNPBN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|