C16H9Cl3N4O3 — CID 3605941
3,5,6-trichloro-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]pyridin-2-amine (PubChem CID 3605941) has the molecular formula C16H9Cl3N4O3 and a molecular weight of 411.63 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 3605941 |
| Molecular Formula | C16H9Cl3N4O3 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | 3,5,6-trichloro-N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(C=NNc3nc(Cl)c(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C16H9Cl3N4O3/c17-12-7-13(18)16(21-15(12)19)22-20-8-11-5-6-14(26-11)9-1-3-10(4-2-9)23(24)25/h1-8H,(H,21,22) |
| InChIKey | NIPPPHUNSRVGEN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|