C23H15N5O3S — CID 5193732
N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 5193732) has the molecular formula C23H15N5O3S and a molecular weight of 441.47 g/mol. Its IUPAC name is N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 5193732 |
| Molecular Formula | C23H15N5O3S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | N-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(C=NNc3ncnc4scc(-c5ccccc5)c34)o2)cc1 |
| InChI | InChI=1S/C23H15N5O3S/c29-28(30)17-8-6-16(7-9-17)20-11-10-18(31-20)12-26-27-22-21-19(15-4-2-1-3-5-15)13-32-23(21)25-14-24-22/h1-14H,(H,24,25,27) |
| InChIKey | HGUWJLILPSRAQU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|