C17H13ClN4O2 — CID 56725889
methyl 4-[(E)-[(3-chloroquinoxalin-2-yl)hydrazinylidene]methyl]benzoate (PubChem CID 56725889) has the molecular formula C17H13ClN4O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is methyl 4-[(E)-[(3-chloroquinoxalin-2-yl)hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[(3-chloroquinoxalin-2-yl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 56725889 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | methyl 4-[(E)-[(3-chloroquinoxalin-2-yl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/Nc2nc3ccccc3nc2Cl)cc1 |
| InChI | InChI=1S/C17H13ClN4O2/c1-24-17(23)12-8-6-11(7-9-12)10-19-22-16-15(18)20-13-4-2-3-5-14(13)21-16/h2-10H,1H3,(H,21,22)/b19-10+ |
| InChIKey | HDCPMJMVHVVHHI-VXLYETTFSA-N |
| XLogP | 3.52 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|