C14H10Cl3N3O2 — CID 4002344
methyl 4-[[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]methyl]benzoate (PubChem CID 4002344) has the molecular formula C14H10Cl3N3O2 and a molecular weight of 358.61 g/mol. Its IUPAC name is methyl 4-[[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 4002344 |
| Molecular Formula | C14H10Cl3N3O2 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | methyl 4-[[(3,5,6-trichloro-2-pyridinyl)hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNc2nc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl3N3O2/c1-22-14(21)9-4-2-8(3-5-9)7-18-20-13-11(16)6-10(15)12(17)19-13/h2-7H,1H3,(H,19,20) |
| InChIKey | QWZPECBUBXCPMI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|