C19H14Cl3N3O — CID 5207019
3,5,6-trichloro-N-[(4-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 5207019) has the molecular formula C19H14Cl3N3O and a molecular weight of 406.70 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[(4-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[(4-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 5207019 |
| Molecular Formula | C19H14Cl3N3O |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 3,5,6-trichloro-N-[(4-phenylmethoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | Clc1cc(Cl)c(NN=Cc2ccc(OCc3ccccc3)cc2)nc1Cl |
| InChI | InChI=1S/C19H14Cl3N3O/c20-16-10-17(21)19(24-18(16)22)25-23-11-13-6-8-15(9-7-13)26-12-14-4-2-1-3-5-14/h1-11H,12H2,(H,24,25) |
| InChIKey | VCOLEUZBFLHWQF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|