C14H12Cl3N3O2 — CID 4237377
3,5,6-trichloro-N-[(3,5-dimethoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 4237377) has the molecular formula C14H12Cl3N3O2 and a molecular weight of 360.63 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[(3,5-dimethoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[(3,5-dimethoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 4237377 |
| Molecular Formula | C14H12Cl3N3O2 |
| Molecular Weight | 360.63 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | 3,5,6-trichloro-N-[(3,5-dimethoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | COc1cc(C=NNc2nc(Cl)c(Cl)cc2Cl)cc(OC)c1 |
| InChI | InChI=1S/C14H12Cl3N3O2/c1-21-9-3-8(4-10(5-9)22-2)7-18-20-14-12(16)6-11(15)13(17)19-14/h3-7H,1-2H3,(H,19,20) |
| InChIKey | IPCMYHSTZQAUHI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|