C16H19Cl3N4 — CID 3317374
3,5,6-trichloro-N-[[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]pyridin-2-amine (PubChem CID 3317374) has the molecular formula C16H19Cl3N4 and a molecular weight of 373.72 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 3317374 |
| Molecular Formula | C16H19Cl3N4 |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 3,5,6-trichloro-N-[[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]pyridin-2-amine |
| SMILES | Cc1cc(C=NNc2nc(Cl)c(Cl)cc2Cl)c(C)n1CC(C)C |
| InChI | InChI=1S/C16H19Cl3N4/c1-9(2)8-23-10(3)5-12(11(23)4)7-20-22-16-14(18)6-13(17)15(19)21-16/h5-7,9H,8H2,1-4H3,(H,21,22) |
| InChIKey | QFSPXKIVLJVGET-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|