C17H21Cl3N5O+ — CID 135701996
4-amino-3,5,6-trichloro-N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]pyridin-1-ium-2-carboxamide (PubChem CID 135701996) has the molecular formula C17H21Cl3N5O+ and a molecular weight of 417.75 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135701996 |
| Molecular Formula | C17H21Cl3N5O+ |
| Molecular Weight | 417.75 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-[2,5-dimethyl-1-(2-methylpropyl)pyrrol-3-yl]methylideneamino]pyridin-1-ium-2-carboxamide |
| SMILES | Cc1cc(/C=N/NC(=O)c2[nH+]c(Cl)c(Cl)c(N)c2Cl)c(C)n1CC(C)C |
| InChI | InChI=1S/C17H20Cl3N5O/c1-8(2)7-25-9(3)5-11(10(25)4)6-22-24-17(26)15-12(18)14(21)13(19)16(20)23-15/h5-6,8H,7H2,1-4H3,(H2,21,23)(H,24,26)/p+1/b22-6+ |
| InChIKey | JNPFIWOGCNBPIW-GEVRCRHISA-O |
| XLogP | 3.88 |
| TPSA | 86.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|