C16H16Cl3N4O+ — CID 135867652
4-amino-3,5,6-trichloro-N-[(Z)-1-phenylbutylideneamino]pyridin-1-ium-2-carboxamide (PubChem CID 135867652) has the molecular formula C16H16Cl3N4O+ and a molecular weight of 386.69 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(Z)-1-phenylbutylideneamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(Z)-1-phenylbutylideneamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135867652 |
| Molecular Formula | C16H16Cl3N4O+ |
| Molecular Weight | 386.69 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(Z)-1-phenylbutylideneamino]pyridin-1-ium-2-carboxamide |
| SMILES | CCC/C(=N/NC(=O)c1[nH+]c(Cl)c(Cl)c(N)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H15Cl3N4O/c1-2-6-10(9-7-4-3-5-8-9)22-23-16(24)14-11(17)13(20)12(18)15(19)21-14/h3-5,7-8H,2,6H2,1H3,(H2,20,21)(H,23,24)/p+1/b22-10- |
| InChIKey | NOCQJAQBTZAOND-YVNNLAQVSA-O |
| XLogP | 3.98 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|