C14H10Cl3F2N4O+ — CID 135850551
4-amino-3,5,6-trichloro-N-[(E)-1-(2,6-difluorophenyl)ethylideneamino]pyridin-1-ium-2-carboxamide (PubChem CID 135850551) has the molecular formula C14H10Cl3F2N4O+ and a molecular weight of 394.62 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(E)-1-(2,6-difluorophenyl)ethylideneamino]pyridin-1-ium-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(E)-1-(2,6-difluorophenyl)ethylideneamino]pyridin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 135850551 |
| Molecular Formula | C14H10Cl3F2N4O+ |
| Molecular Weight | 394.62 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(E)-1-(2,6-difluorophenyl)ethylideneamino]pyridin-1-ium-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1[nH+]c(Cl)c(Cl)c(N)c1Cl)c1c(F)cccc1F |
| InChI | InChI=1S/C14H9Cl3F2N4O/c1-5(8-6(18)3-2-4-7(8)19)22-23-14(24)12-9(15)11(20)10(16)13(17)21-12/h2-4H,1H3,(H2,20,21)(H,23,24)/p+1/b22-5+ |
| InChIKey | GNJVFUOIQDLEJQ-RREIPUBJSA-O |
| XLogP | 3.48 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|