C14H11BrF2N2O2S — CID 9120988
4-bromo-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]benzenesulfonamide (PubChem CID 9120988) has the molecular formula C14H11BrF2N2O2S and a molecular weight of 389.22 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 9120988 |
| Molecular Formula | C14H11BrF2N2O2S |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 4-bromo-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]benzenesulfonamide |
| SMILES | C/C(=N/NS(=O)(=O)c1ccc(Br)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C14H11BrF2N2O2S/c1-9(14-12(16)3-2-4-13(14)17)18-19-22(20,21)11-7-5-10(15)6-8-11/h2-8,19H,1H3/b18-9- |
| InChIKey | ILCLCDUHTHGPMB-NVMNQCDNSA-N |
| XLogP | 3.43 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|