C14H15BrN2O2S2 — CID 9120973
4-bromo-N-[(Z)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]benzenesulfonamide (PubChem CID 9120973) has the molecular formula C14H15BrN2O2S2 and a molecular weight of 387.32 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(Z)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 9120973 |
| Molecular Formula | C14H15BrN2O2S2 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 4-bromo-N-[(Z)-1-(2,5-dimethylthiophen-3-yl)ethylideneamino]benzenesulfonamide |
| SMILES | C/C(=N/NS(=O)(=O)c1ccc(Br)cc1)c1cc(C)sc1C |
| InChI | InChI=1S/C14H15BrN2O2S2/c1-9-8-14(11(3)20-9)10(2)16-17-21(18,19)13-6-4-12(15)5-7-13/h4-8,17H,1-3H3/b16-10- |
| InChIKey | CJEFKKZRZPNNFL-YBEGLDIGSA-N |
| XLogP | 3.83 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|