C20H17F2N3O2S — CID 8869800
3-amino-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]-5-(4-methoxyphenyl)thiophene-2-carboxamide (PubChem CID 8869800) has the molecular formula C20H17F2N3O2S and a molecular weight of 401.44 g/mol. Its IUPAC name is 3-amino-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]-5-(4-methoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]-5-(4-methoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 8869800 |
| Molecular Formula | C20H17F2N3O2S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 3-amino-N-[(Z)-1-(2,6-difluorophenyl)ethylideneamino]-5-(4-methoxyphenyl)thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2cc(N)c(C(=O)N/N=C(/C)c3c(F)cccc3F)s2)cc1 |
| InChI | InChI=1S/C20H17F2N3O2S/c1-11(18-14(21)4-3-5-15(18)22)24-25-20(26)19-16(23)10-17(28-19)12-6-8-13(27-2)9-7-12/h3-10H,23H2,1-2H3,(H,25,26)/b24-11- |
| InChIKey | LIPLQHCSLDZCKP-MYKKPKGFSA-N |
| XLogP | 4.44 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|