C21H21N3O2S — CID 8869920
3-amino-5-(4-methoxyphenyl)-N-[(Z)-[(2R)-2-phenylpropylidene]amino]thiophene-2-carboxamide (PubChem CID 8869920) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 3-amino-5-(4-methoxyphenyl)-N-[(Z)-[(2R)-2-phenylpropylidene]amino]thiophene-2-carboxamide.
| Compound Name | 3-amino-5-(4-methoxyphenyl)-N-[(Z)-[(2R)-2-phenylpropylidene]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 8869920 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-amino-5-(4-methoxyphenyl)-N-[(Z)-[(2R)-2-phenylpropylidene]amino]thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2cc(N)c(C(=O)N/N=C\[C@H](C)c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C21H21N3O2S/c1-14(15-6-4-3-5-7-15)13-23-24-21(25)20-18(22)12-19(27-20)16-8-10-17(26-2)11-9-16/h3-14H,22H2,1-2H3,(H,24,25)/b23-13-/t14-/m0/s1 |
| InChIKey | PXKDJKYARPAYCT-LTOJSDLTSA-N |
| XLogP | 4.53 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|