C14H12Cl3N5O — CID 9214641
4-amino-N-[(Z)-1-(3-aminophenyl)ethylideneamino]-3,5,6-trichloropyridine-2-carboxamide (PubChem CID 9214641) has the molecular formula C14H12Cl3N5O and a molecular weight of 372.64 g/mol. Its IUPAC name is 4-amino-N-[(Z)-1-(3-aminophenyl)ethylideneamino]-3,5,6-trichloropyridine-2-carboxamide.
| Compound Name | 4-amino-N-[(Z)-1-(3-aminophenyl)ethylideneamino]-3,5,6-trichloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 9214641 |
| Molecular Formula | C14H12Cl3N5O |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 4-amino-N-[(Z)-1-(3-aminophenyl)ethylideneamino]-3,5,6-trichloropyridine-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nc(Cl)c(Cl)c(N)c1Cl)c1cccc(N)c1 |
| InChI | InChI=1S/C14H12Cl3N5O/c1-6(7-3-2-4-8(18)5-7)21-22-14(23)12-9(15)11(19)10(16)13(17)20-12/h2-5H,18H2,1H3,(H2,19,20)(H,22,23)/b21-6- |
| InChIKey | BUGNIZGNGBHGHH-MPUCSWFWSA-N |
| XLogP | 3.36 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|