C14H10Cl3N5O3 — CID 9214514
4-amino-3,5,6-trichloro-N-[(Z)-1-(2-nitrophenyl)ethylideneamino]pyridine-2-carboxamide (PubChem CID 9214514) has the molecular formula C14H10Cl3N5O3 and a molecular weight of 402.63 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[(Z)-1-(2-nitrophenyl)ethylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[(Z)-1-(2-nitrophenyl)ethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 9214514 |
| Molecular Formula | C14H10Cl3N5O3 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[(Z)-1-(2-nitrophenyl)ethylideneamino]pyridine-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nc(Cl)c(Cl)c(N)c1Cl)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10Cl3N5O3/c1-6(7-4-2-3-5-8(7)22(24)25)20-21-14(23)12-9(15)11(18)10(16)13(17)19-12/h2-5H,1H3,(H2,18,19)(H,21,23)/b20-6- |
| InChIKey | KIHWPFAUAIJTPA-IOXNKQMXSA-N |
| XLogP | 3.69 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|