C17H13Cl3N6O — CID 5098964
4-amino-3,5,6-trichloro-N-[1-(4-imidazol-1-ylphenyl)ethylideneamino]pyridine-2-carboxamide (PubChem CID 5098964) has the molecular formula C17H13Cl3N6O and a molecular weight of 423.69 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-[1-(4-imidazol-1-ylphenyl)ethylideneamino]pyridine-2-carboxamide.
| Compound Name | 4-amino-3,5,6-trichloro-N-[1-(4-imidazol-1-ylphenyl)ethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 5098964 |
| Molecular Formula | C17H13Cl3N6O |
| Molecular Weight | 423.69 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-[1-(4-imidazol-1-ylphenyl)ethylideneamino]pyridine-2-carboxamide |
| SMILES | CC(=NNC(=O)c1nc(Cl)c(Cl)c(N)c1Cl)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C17H13Cl3N6O/c1-9(10-2-4-11(5-3-10)26-7-6-22-8-26)24-25-17(27)15-12(18)14(21)13(19)16(20)23-15/h2-8H,1H3,(H2,21,23)(H,25,27) |
| InChIKey | ACIJYBUBBHFWBM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|